CymitQuimica logo

CAS 252919-08-7

:

N-[(Phenylmethoxy)Carbonyl]-N-(Phenylmethyl)-Beta-Alanine

Description:
N-[(Phenylmethoxy)Carbonyl]-N-(Phenylmethyl)-Beta-Alanine, with the CAS number 252919-08-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a beta-alanine backbone, which is an amino acid known for its role in various biochemical processes. The compound is characterized by the presence of a phenylmethoxycarbonyl group, which enhances its stability and solubility, as well as a phenylmethyl substituent that may influence its biological activity and interaction with receptors or enzymes. Typically, such compounds are studied for their potential applications in pharmaceuticals, particularly in drug design and development, due to their ability to mimic natural amino acids while providing unique functional properties. The presence of aromatic groups in its structure may also contribute to its hydrophobic characteristics, affecting its distribution and metabolism in biological systems. Overall, this compound represents a valuable structure for research in medicinal chemistry and related fields.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c20-17(21)11-12-19(13-15-7-3-1-4-8-15)18(22)23-14-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,20,21)
InChI key:RGNBASLLMGVXSF-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CN(CCC(=O)O)C(=O)OCC2=CC=CC=C2
Found 4 products.