CAS 252920-94-8: Solabegron
Description:Solabegron is a selective beta-3 adrenergic receptor agonist, primarily investigated for its potential therapeutic applications in treating overactive bladder and other conditions related to urinary incontinence. As a chemical entity, it exhibits a unique structure that allows it to selectively activate beta-3 adrenergic receptors, which play a crucial role in bladder relaxation and increased capacity. Solabegron is characterized by its moderate lipophilicity, which influences its absorption and distribution in biological systems. The compound is typically administered orally and has been studied for its pharmacokinetic properties, including metabolism and excretion pathways. Its safety profile and efficacy have been evaluated in clinical trials, highlighting its potential benefits over traditional treatments for urinary disorders. However, as with any pharmacological agent, the therapeutic use of Solabegron may be accompanied by side effects, which necessitate careful consideration in clinical settings. Overall, Solabegron represents a promising advancement in the management of bladder-related conditions, reflecting ongoing research in the field of urology and pharmacotherapy.
Formula:C23H23ClN2O3
InChI:InChI=1S/C23H23ClN2O3/c24-20-8-2-6-18(13-20)22(27)15-25-10-11-26-21-9-3-5-17(14-21)16-4-1-7-19(12-16)23(28)29/h1-9,12-14,22,25-27H,10-11,15H2,(H,28,29)/t22-/m0/s1
InChI key:InChIKey=LLDXOPKUNJTIRF-QFIPXVFZSA-N
SMILES:O=C(O)C1=CC=CC(=C1)C2=CC=CC(=C2)NCCNCC(O)C=3C=CC=C(Cl)C3
- Synonyms:
- (-)-(R)-3′-[[2-[[2-(3-Chlorophenyl)-2-hydroxyethyl]amino]ethyl]amino]biphenyl-3-carboxylic acid
- 3′-[[2-[[(2R)-2-(3-Chlorophenyl)-2-hydroxyethyl]amino]ethyl]amino][1,1′-biphenyl]-3-carboxylic acid
- Gw 427353
- Solabegron
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-[[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]amino]-