CymitQuimica logo

CAS 252928-82-8

:

3-(5-Oxazolyl)benzoic acid

Description:
3-(5-Oxazolyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a 5-oxazolyl group. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidic properties and potential for forming hydrogen bonds. The oxazole ring, a five-membered heterocycle containing both nitrogen and oxygen, imparts unique electronic and steric properties, influencing the compound's reactivity and solubility. Typically, compounds like 3-(5-oxazolyl)benzoic acid exhibit moderate to high polarity due to the presence of the carboxylic acid group, which can enhance solubility in polar solvents. Additionally, the presence of the oxazole ring may provide opportunities for various chemical reactions, including nucleophilic substitutions or cycloadditions. This compound may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to its structural features that can facilitate interactions with biological targets or other chemical entities.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-10(13)8-3-1-2-7(4-8)9-5-11-6-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=GDGXRJDVOKNSCX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CN=CO2
Synonyms:
  • 3-(5-Oxazolyl)benzoic acid
  • 3-(1,3-Oxazol-5-yl)benzoic acid
  • Benzoic acid, 3-(5-oxazolyl)-
  • 3-(Oxazol-5-yl)benzoic acid
Found 4 products.