CAS 252938-22-0
:Dimethyl (4-fluorobenzyl)malonate
Description:
Dimethyl (4-fluorobenzyl)malonate is an organic compound characterized by its structure, which includes a malonate moiety and a 4-fluorobenzyl group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the fluorine atom in the benzyl group can influence the compound's reactivity and polarity, making it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. This compound is likely to exhibit moderate solubility in organic solvents due to its ester functional groups, while its solubility in water may be limited. Dimethyl (4-fluorobenzyl)malonate can participate in various chemical reactions, including esterification and nucleophilic substitution, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its use.
Formula:C12H13FO4
InChI:InChI=1/C12H13FO4/c1-16-11(14)10(12(15)17-2)7-8-3-5-9(13)6-4-8/h3-6,10H,7H2,1-2H3
SMILES:COC(=O)C(Cc1ccc(cc1)F)C(=O)OC
Synonyms:- Propanedioic Acid, 2-[(4-Fluorophenyl)Methyl]-, Dimethyl Ester
- Dimethyl (4-Fluorobenzyl)Propanedioate
- Dimethyl (4-fluorobenzyl)malonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dimethyl (4-fluorobenzyl)malonate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H13FO4Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:240.231,3-dimethyl 2-[(4-fluorophenyl)methyl]propanedioate
CAS:Formula:C12H13FO4Purity:95%Molecular weight:240.2276Dimethyl 2-(4-fluorobenzyl)malonate
CAS:Dimethyl 2-(4-fluorobenzyl)malonatePurity:≥95%Color and Shape:SolidMolecular weight:240.23g/mol



