CAS 252978-89-5

tert-butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate

Description:

Tert-butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate, with the CAS number 252978-89-5, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, an indole moiety, and a piperazine ring. This compound typically exhibits properties associated with both the indole and piperazine functionalities, such as potential biological activity and solubility in organic solvents. The presence of the tert-butyl group enhances its lipophilicity, which can influence its pharmacokinetic properties. The indole structure is known for its role in various biological processes and can contribute to the compound's interaction with biological targets. Additionally, the carboxylate group may participate in hydrogen bonding and ionic interactions, further affecting the compound's reactivity and stability. Overall, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of neuropharmacology or as a scaffold for synthesizing other bioactive molecules.

Formula: C₁₇H₂₃N₃O₂

InChI: InChI=1/C17H23N3O2/c1-17(2,3)22-16(21)20-11-9-19(10-12-20)15-6-4-5-14-13(15)7-8-18-14/h4-8,18H,9-12H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)c1cccc2c1cc[nH]2

Synonyms:

• 1-piperazinecarboxylic acid, 4-(1H-indol-4-yl)-, 1,1-dimethylethyl ester

tert-Butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate

CAS: 252978-89-5

Formula: C₁₇H₂₃N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 301.3834

Ref: IN-DA006WB4

tert-Butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate

CAS: 252978-89-5

tert-Butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate

Purity: 95%

Molecular weight: 301.39g/mol

Ref: 54-OR1051737

Tert-Butyl 4-(1H-indol-4-yl)piperazine-1-carboxylate

CAS: 252978-89-5

Purity: 97.0%

Molecular weight: 301.3900146484375

Ref: 10-F547212