CAS 2530-07-6

Tigogenin acetate

Description:

Tigogenin acetate is a steroidal sapogenin derived from various plant sources, particularly from the genus Dioscorea. It is characterized by its molecular structure, which includes a steroid nucleus with specific functional groups that contribute to its biological activity. The compound is typically a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. Tigogenin acetate is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities, making it of interest in medicinal chemistry and natural product research. Its acetate form indicates the presence of an acetyl group, which can influence its reactivity and biological interactions. As with many steroid derivatives, it may also exhibit hormonal activity, although its specific mechanisms of action require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₂₉H₄₆O₄

InChI: InChI=1S/C29H46O4/c1-17-8-13-29(31-16-17)18(2)26-25(33-29)15-24-22-7-6-20-14-21(32-19(3)30)9-11-27(20,4)23(22)10-12-28(24,26)5/h17-18,20-26H,6-16H2,1-5H3/t17-,18+,20+,21+,22-,23+,24+,25+,26+,27+,28+,29-/m1/s1

InChI key: InChIKey=LVRAKYNQYKVPIK-OMRXZHHXSA-N

SMILES: C[C@@]12[C@@]3([C@@](O[C@@]4([C@H]3C)CC[C@@H](C)CO4)(C[C@]1([C@]5([C@](CC2)([C@]6(C)[C@@](CC5)(C[C@@H](OC(C)=O)CC6)[H])[H])[H])[H])[H])[H]

Synonyms:

• Spirostan-3-ol, acetate, (3β,5α,25R)-
• 5α-Spirostan-3β-ol, acetate, (25R)-
• O-Acetyltigogenin
• Tigogenin acetate

Tigogenin acetate

CAS: 2530-07-6

Tigogenin acetate is a natural product for research related to life sciences. The catalog number is TN6601 and the CAS number is 2530-07-6.

Formula: C₂₉H₄₆O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 458.67

Ref: TM-TN6601

Tigogenin acetate

CAS: 2530-07-6

Tigogenin acetate is a steroidal sapogenin, which is a metabolite derived from plants, primarily from the abundant Dioscorea species, commonly known as yams. The compound is characterized by its acetate group, which enhances its stability and bioavailability. Tigogenin acetate acts mainly through its interaction with biological membranes and exhibits a range of modulatory effects on cellular processes. As a steroidal compound, it can influence membrane fluidity and signaling pathways, which underpins its biological activity.

Formula: C₂₉H₄₆O₄

Purity: Min. 95%

Molecular weight: 458.70 g/mol

Ref: 3D-CAA53007