
CAS 25300-99-6
:Methacrylic anhydride homopolymer
Description:
Methacrylic anhydride homopolymer, identified by CAS number 25300-99-6, is a synthetic polymer derived from methacrylic anhydride. This polymer exhibits several notable characteristics, including high thermal stability and excellent chemical resistance, making it suitable for various industrial applications. It is typically a solid at room temperature and can be processed into different forms, such as films or coatings. The polymer is known for its good adhesion properties and can be used in adhesives, sealants, and coatings due to its ability to form strong bonds with various substrates. Additionally, it has a relatively high glass transition temperature, which contributes to its rigidity and durability. Methacrylic anhydride homopolymer is also characterized by its transparency and can be modified to enhance specific properties, such as flexibility or impact resistance. Safety considerations include handling precautions due to potential irritants during processing, and it is essential to follow appropriate guidelines for storage and disposal. Overall, this polymer is valued for its versatility and performance in demanding applications.
Formula:(C8H10O3)x
InChI:InChI=1S/C8H10O3/c1-5(2)7(9)11-8(10)6(3)4/h1,3H2,2,4H3
InChI key:InChIKey=DCUFMVPCXCSVNP-UHFFFAOYSA-N
SMILES:C(OC(C(C)=C)=O)(C(C)=C)=O
Synonyms:- Methacrylic anhydride polymer
- Methacrylic anhydride, polymers
- Poly(methacrylic anhydride)
- 2-Propenoic acid, 2-methyl-, 1,1′-anhydride, homopolymer
- 2-Propenoic acid, 2-methyl-, anhydride, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
