CAS 25308-75-2
:1-phenylcycloheptene
Description:
1-Phenylcycloheptene is an organic compound characterized by a cycloheptene ring with a phenyl group attached to it. This compound features a seven-membered carbon ring that contains one double bond, which contributes to its unsaturation and reactivity. The presence of the phenyl group, a six-membered aromatic ring, enhances the compound's stability and influences its chemical properties. 1-Phenylcycloheptene is typically a colorless to pale yellow liquid at room temperature and exhibits a distinct aromatic odor. It is relatively hydrophobic, making it soluble in organic solvents but not in water. The compound can participate in various chemical reactions, including electrophilic addition and substitution reactions, due to the presence of the double bond. Its unique structure makes it of interest in organic synthesis and materials science. Safety data should be consulted for handling and storage, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C13H16
InChI:InChI=1/C13H16/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-13/h3,6-8,10-11H,1-2,4-5,9H2
SMILES:C1CCCC(=CC1)c1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Phenylcyclohept-1-ene
CAS:1-Phenylcyclohept-1-ene is a chemical reagent that is used in the production of polymers. It belongs to the dichlorocarbene class of hypervalent molecules and can be used for the preparation of styrene derivatives, such as iminium ions and halides. 1-Phenylcyclohept-1-ene also reacts with hypobromous acid to form pyridinium chlorochromate, which is a useful oxidizing agent. The rate of 1-phenylcyclohept-1-ene reactions has been studied using kinetics methods. This compound has shown to be an effective sensitizer for radiation polymerization processes.Formula:C13H16Purity:Min. 95%Molecular weight:172.27 g/mol
