CAS 253136-30-0

1-(1,1-Dimethylethyl) octahydro-1,2(2H)-quinolinedicarboxylate

Description:

1-(1,1-Dimethylethyl) octahydro-1,2(2H)-quinolinedicarboxylate, with the CAS number 253136-30-0, is a chemical compound characterized by its complex structure, which includes a quinoline core and two carboxylate ester functional groups. This compound typically exhibits a relatively high molecular weight and is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, which can influence its reactivity and solubility in various solvents. The octahydroquinoline structure suggests that it may possess interesting pharmacological properties, potentially acting as a precursor or intermediate in the synthesis of biologically active compounds. Additionally, the presence of carboxylate groups may enhance its solubility in polar solvents and facilitate interactions with biological systems. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and materials science.

Formula: C₁₅H₂₅NO₄

InChI: InChI=1S/C15H25NO4/c1-15(2,3)20-14(19)16-11-7-5-4-6-10(11)8-9-12(16)13(17)18/h10-12H,4-9H2,1-3H3,(H,17,18)

InChI key: InChIKey=GHHISGFNVINWNL-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2C(CCC1C(O)=O)CCCC2

Synonyms:

• 1-[(tert-Butoxy)carbonyl]-decahydroquinoline-2-carboxylic acid
• 1,2(2H)-Quinolinedicarboxylic acid, octahydro-, 1-(1,1-dimethylethyl) ester
• 1-(1,1-Dimethylethyl) octahydro-1,2(2H)-quinolinedicarboxylate

1-[(tert-Butoxy)carbonyl]-decahydroquinoline-2-carboxylic acid

CAS: 253136-30-0

Versatile small molecule scaffold

Formula: C₁₅H₂₅NO₄

Purity: Min. 95%

Molecular weight: 283.36 g/mol

Ref: 3D-DKA13630