
CAS 253176-46-4: 1-Piperazinesulfonamide, N,N-dimethyl-, hydrochloride (1:1)
Description:1-Piperazinesulfonamide, N,N-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine ring structure, which is a six-membered cyclic amine. This compound features a sulfonamide functional group, contributing to its potential biological activity. The presence of the N,N-dimethyl substituents enhances its solubility and may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on its interaction with biological targets. Its molecular structure allows for potential modifications, which can lead to derivatives with varied therapeutic profiles. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Overall, 1-Piperazinesulfonamide, N,N-dimethyl-, hydrochloride is of interest in medicinal chemistry and drug development due to its unique structural features and potential biological applications.
Formula:C6H15N3O2S·ClH
InChI:InChI=1S/C6H15N3O2S.ClH/c1-8(2)12(10,11)9-5-3-7-4-6-9;/h7H,3-6H2,1-2H3;1H
InChI key:InChIKey=HLSJHTCIYSDJIF-UHFFFAOYSA-N
SMILES:Cl.O=S(=O)(N(C)C)N1CCNCC1
- Synonyms:
- 1-Piperazinesulfonamide, N,N-dimethyl-, monohydrochloride
- 1-Piperazinesulfonamide, N,N-dimethyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N,N-Dimethylpiperazine-1-sulfonamide hydrochloride REF: 3D-DKA17646CAS: 253176-46-4 | Min. 95% | To inquire | Mon 19 May 25 |
![]() | n,n-Dimethylpiperazine-1-sulfonamide hydrochloride REF: 10-F640047CAS: 253176-46-4 | 97% | - - - | Discontinued product |

N,N-Dimethylpiperazine-1-sulfonamide hydrochloride
Ref: 3D-DKA17646
1g | 418.00 € | ||
10g | 1,548.00 € |

n,n-Dimethylpiperazine-1-sulfonamide hydrochloride
Ref: 10-F640047
10g | Discontinued | Request information |