CAS 25320-59-6
:(3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-chloro-tetrahydropyran
Description:
The chemical substance known as (3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-chloro-tetrahydropyran, with the CAS number 25320-59-6, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy groups, indicating the presence of benzyl ether functionalities that enhance its lipophilicity and potentially influence its reactivity and solubility in organic solvents. The presence of a chlorine atom at the 6-position introduces a halogen, which can affect the compound's reactivity, making it a potential candidate for further chemical transformations. The stereochemistry, denoted by the (3R,4S,5S,6R) configuration, suggests specific spatial arrangements of substituents that can significantly impact the compound's biological activity and interaction with other molecules. Overall, this compound may be of interest in synthetic organic chemistry and medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis.
Formula:C34H35ClO5
InChI:InChI=1/C34H35ClO5/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-34H,21-25H2/t30?,31-,32+,33+,34+/m1/s1
Synonyms:- 2,3,4,6-Tetra-O-Benzyl-A-D-Glucopyranosylchloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl chloride
CAS:<p>2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl chloride is a cholic acid derivative that is used as a bile acid. It has been shown to be effective in the treatment of gallstones and other conditions involving hypercholesterolemia and cholesterol gallstones. 2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl chloride is synthesized by coupling acetyl chloride with 2,3,4,6 tetra O benzyl a D glucopyranoside. The acetate group is then removed to form the desired product.</p>Formula:C34H35ClO5Purity:Min. 95%Color and Shape:PowderMolecular weight:559.09 g/mol

