CAS 253315-22-9
:6-(1H-Pyrazol-1-yl)nicotinic acid
Description:
6-(1H-Pyrazol-1-yl)nicotinic acid is a chemical compound characterized by its dual functionality, featuring both a pyrazole and a nicotinic acid moiety. This compound typically exhibits a molecular structure that includes a pyridine ring, which is part of the nicotinic acid structure, and a pyrazole ring, which contributes to its unique chemical properties. It is often studied for its potential biological activities, including its role in medicinal chemistry and as a potential pharmacophore in drug development. The presence of both nitrogen-containing heterocycles may enhance its interaction with biological targets, making it of interest in the fields of pharmacology and biochemistry. Additionally, this compound may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and the ability to form hydrogen bonds due to the presence of carboxylic acid and nitrogen atoms. Its specific applications and reactivity can vary based on the context of its use in research or industry.
Formula:C9H7N3O2
InChI:InChI=1/C9H7N3O2/c13-9(14)7-2-3-8(10-6-7)12-5-1-4-11-12/h1-6H,(H,13,14)
SMILES:c1cnn(c1)c1ccc(cn1)C(=O)O
Synonyms:- 3-Pyridinecarboxylic acid, 6-(1H-pyrazol-1-yl)-
- 6-(1H-pyrazol-1-yl)pyridine-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-(1H-Pyrazol-1-yl)nicotinic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H7N3O2Purity:97%Color and Shape:White, PowderMolecular weight:189.26-(1H-PYRAZOL-1-YL)NICOTINIC ACID
CAS:Formula:C9H7N3O2Purity:98%Color and Shape:SolidMolecular weight:189.17086-(1H-Pyrazol-1-yl)nicotinic acid
CAS:6-(1H-Pyrazol-1-yl)nicotinic acidFormula:C9H7N3O2Purity:97%Color and Shape: white to off-white solidMolecular weight:189.17g/mol



