
CAS 25332-05-2
:N-(2,6-Dimethylphenyl)-4,5-dihydro-2-thiazolamine
Description:
N-(2,6-Dimethylphenyl)-4,5-dihydro-2-thiazolamine, identified by its CAS number 25332-05-2, is an organic compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by its amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the 2,6-dimethylphenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The thiazole moiety is often associated with diverse biological properties, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structural features suggest potential for use in organic synthesis and as intermediates in the development of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for detailed applications and handling guidelines.
Formula:C11H14N2S
InChI:InChI=1S/C11H14N2S/c1-8-4-3-5-9(2)10(8)13-11-12-6-7-14-11/h3-5H,6-7H2,1-2H3,(H,12,13)
InChI key:InChIKey=VLUXBNSRYHXDBV-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=CC=C1C)C2=NCCS2
Synonyms:- 2-(2,6-Xylidino)-2-thiazoline
- N-(2,6-Dimethylphenyl)-4,5-dihydro-2-thiazolamine
- 2-(2,6-Dimethylanilino)-2-thiazoline
- 2-Thiazolamine, N-(2,6-dimethylphenyl)-4,5-dihydro-
- 2-Thiazoline, 2-(2,6-xylidino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Jingsongling
CAS:Jingsongling is a biochemical.Formula:C11H14N2SColor and Shape:SolidMolecular weight:206.31
