CAS 253429-31-1

7-bromo-4-fluoro-1-benzofuran

Description:

7-Bromo-4-fluoro-1-benzofuran is a chemical compound characterized by its unique structure, which includes a benzofuran core substituted with bromine and fluorine atoms. The presence of the bromine atom at the 7-position and the fluorine atom at the 4-position contributes to its reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound is typically a solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effects of the halogen substituents. Additionally, the presence of these halogens can influence the compound's physical properties, such as boiling and melting points, as well as its spectral characteristics in techniques like NMR and IR spectroscopy. Overall, 7-bromo-4-fluoro-1-benzofuran is of interest for its potential utility in synthetic organic chemistry and its role in the development of novel chemical entities.

Formula: C₈H₄BrFO

InChI: InChI=1/C8H4BrFO/c9-6-1-2-7(10)5-3-4-11-8(5)6/h1-4H

SMILES: c1cc(c2ccoc2c1Br)F

Synonyms:

• Benzofuran, 7-bromo-4-fluoro-
• 7-Bromo-4-fluorobenzofuran
• 7-Bromo-4-fluoro-1-benzofuran

7-bromo-4-fluorobenzofuran

CAS: 253429-31-1

Formula: C₈H₄BrFO

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.0192

Ref: IN-DA003LEQ

7-Bromo-4-fluorobenzo[b]furan

CAS: 253429-31-1

7-Bromo-4-fluorobenzo[b]furan

Purity: ≥95%

Color and Shape: Off-White Low-Melting Solid

Molecular weight: 215.02g/mol

Ref: 54-PC3668

7-Bromo-4-fluorobenzofuran

CAS: 253429-31-1

Formula: C₈H₄BrFO

Purity: 95%

Molecular weight: 215.021

Ref: 10-F236531