CymitQuimica logo

CAS 25343-32-2

:

1-[2-(1-methylethyl)phenyl]thiourea

Description:
1-[2-(1-methylethyl)phenyl]thiourea, with the CAS number 25343-32-2, is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen atoms. This compound features a phenyl ring substituted with an isopropyl group, contributing to its hydrophobic characteristics. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar nature. The presence of the thiourea moiety imparts unique chemical reactivity, making it useful in various applications, including as a reagent in organic synthesis and potentially in biological systems. The compound may exhibit biological activity, which can be explored in pharmacological studies. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-[2-(1-methylethyl)phenyl]thiourea is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C10H14N2S
InChI:InChI=1/C10H14N2S/c1-7(2)8-5-3-4-6-9(8)12-10(11)13/h3-7H,1-2H3,(H3,11,12,13)
InChI key:FUKKXMVIGCLNGG-UHFFFAOYSA-N
SMILES:CC(C)c1ccccc1NC(=N)S
Synonyms:
  • 1-(2-Isopropylphenyl)thiourea
  • Thiourea, N-[2-(1-methylethyl)phenyl]-
Found 3 products.