CAS 25343-69-5
:2,6-Diethylphenyl isothiocyanate
Description:
2,6-Diethylphenyl isothiocyanate is an organic compound characterized by the presence of an isothiocyanate functional group attached to a diethyl-substituted phenyl ring. It is typically a yellowish liquid with a pungent odor, indicative of its reactivity and potential toxicity. This compound is known for its role in various chemical reactions, particularly in the synthesis of other organic compounds and as a reagent in chemical research. Isothiocyanates are generally recognized for their biological activity, including potential antimicrobial and anticancer properties. The presence of the ethyl groups on the phenyl ring influences its solubility and reactivity, making it more lipophilic compared to its non-substituted counterparts. Safety precautions are necessary when handling this compound, as isothiocyanates can be irritants and may pose health risks upon exposure. Overall, 2,6-Diethylphenyl isothiocyanate serves as an important compound in both synthetic organic chemistry and biological studies.
Formula:C11H13NS
InChI:InChI=1/C11H13NS/c1-3-9-6-5-7-10(4-2)11(9)12-8-13/h5-7H,3-4H2,1-2H3
SMILES:CCc1cccc(CC)c1N=C=S
Synonyms:- 1,3-Diethyl-2-Isothiocyanatobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Diethylphenyl isothiocyanate
CAS:Formula:C11H13NSPurity:95%Color and Shape:SolidMolecular weight:191.29262,6-Diethylphenylisothiocyanate
CAS:<p>2,6-Diethylphenylisothiocyanate</p>Purity:≥95%Molecular weight:191.29g/mol2,6-Diethylphenyl isothiocyanate
CAS:Formula:C11H13NSPurity:95%Color and Shape:LiquidMolecular weight:191.292,6-Diethylphenylisothiocyanate
CAS:<p>2,6-Diethylphenylisothiocyanate is an aliphatic anesthetic agent that binds to the acceptor site of the ligand-gated ion channels. It has a hydrophobic nature and can be used for research as a potential drug candidate for a variety of protein targets. This compound also has the ability to alter conformations of proteins such as apoferritin, which may lead to new insights into how these proteins function.</p>Formula:C11H13NSPurity:Min. 95%Molecular weight:191.29 g/mol
