CAS 253449-04-6
:1-(3,6-dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-ol
Description:
1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-ol is a complex organic compound characterized by its unique structure, which includes a carbazole moiety and a dimethylamino group. The presence of bromine atoms in the 3 and 6 positions of the carbazole ring contributes to its reactivity and potential applications in various fields, including organic electronics and photonics. The dimethylamino group enhances the compound's solubility and may influence its electronic properties, making it suitable for use in dye-sensitized solar cells or as a fluorescent probe. This compound is likely to exhibit interesting photophysical properties, such as fluorescence, due to the conjugated system formed by the carbazole structure. Additionally, the presence of the alcohol functional group (propan-2-ol) suggests potential for hydrogen bonding, which could affect its interactions in solution and with other materials. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in materials science and organic chemistry research.
Formula:C17H18Br2N2O
InChI:InChI=1/C17H18Br2N2O/c1-20(2)9-13(22)10-21-16-5-3-11(18)7-14(16)15-8-12(19)4-6-17(15)21/h3-8,13,22H,9-10H2,1-2H3
InChI key:InChIKey=XUBJEDZHBUPBKL-UHFFFAOYSA-N
SMILES:C(C(CN(C)C)O)N1C=2C(C=3C1=CC=C(Br)C3)=CC(Br)=CC2
Synonyms:- 1-(3,6-Dibromo-carbazol-9-yl)-3-dimethylamino-propan-2-ol
- 1-(3,6-Dibromocarbazol-9-yl)-3-(dimethylamino)propan-2-ol
- 3,6-Dibromo-α-[(dimethylamino)methyl]-9H-carbazole-9-ethanol
- 9H-Carbazole-9-ethanol, 3,6-dibromo-α-[(dimethylamino)methyl]-
- 9H-carbazole-9-ethanol, 3,6-dibromo-alpha-[(dimethylamino)methyl]-
- Wiskostatin
- 1-(3,6-DIBROMO-9H-CARBAZOL-9-YL)-3-(DIMETHYLAMINO)PROPAN-2-OL
- 3,6-Dibromo-9-[3-(dimethylamino)-2-hydroxyprop-1-yl]-9H-carbazole, 3-(3,6-Dibromo-9H-carbazol-9-yl)-N,N-dimethyl-2-hydroxypropylamine
- 3,6-Dibromo-α-[(dimethylamino)methyl]-9H-cabazole-9-ethanol
- 1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-ol 97%
- Wiskostatin - CAS 253449-04-6 - Calbiochem
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Wiskostatin
CAS:Wiskostatin selectively inhibits N-WASP, key in actin polymerization, linked to Wiskott-Aldrich Syndrome.Formula:C17H18Br2N2OPurity:99.84% - 99.97%Color and Shape:White SolidMolecular weight:426.151-(3,6-Dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-ol
CAS:1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-olFormula:C17H18Br2N2OPurity:97%Color and Shape: white crystalline powderMolecular weight:426.15g/molWiskostatin
CAS:Controlled Product<p>Applications Wiskostatin is an selective inhibitor of neural Wiskott-Aldrich syndrome protein (WASP).<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Peterson, J.R., et al.: Nat. Struct. Mol. Biol., 11, 747 (2004)<br></p>Formula:C17H18Br2N2OColor and Shape:NeatMolecular weight:426.151-(3,6-Dibromo-9H-carbazol-9-yl)-3-(dimethylamino)propan-2-ol
CAS:<p>1,3-Bis(3,6-dibromo-9H-carbazol-9-yl)-2-(dimethylamino)propanol (1,3BDCP) is a potential biomarker for cancer tissues. It has been shown to induce autophagy in vitro and in vivo. 1,3BDCP increases the production of growth factor β1 to inhibit cell proliferation and promote apoptosis. It also induces cytosolic Ca2+ release through increased membrane permeability. 1,3BDCP is an autophagy inducer and promotes pluripotent cells with apical properties. This compound can be used as a chemical probe for chemical biology research due to its constant pressure behavior and chemical reactivity.</p>Formula:C17H18Br2N2OPurity:Min. 95%Molecular weight:426.15 g/mol





