CAS 253450-09-8
:6-({2-[4-(4-fluorobenzyl)piperidin-1-yl]ethyl}sulfinyl)-1,3-benzoxazol-2(3H)-one
Description:
The chemical substance known as 6-({2-[4-(4-fluorobenzyl)piperidin-1-yl]ethyl}sulfinyl)-1,3-benzoxazol-2(3H)-one, with the CAS number 253450-09-8, is a complex organic compound characterized by its unique structural features. It contains a benzoxazole core, which is a bicyclic structure that includes both a benzene ring and an oxazole ring, contributing to its potential biological activity. The presence of a sulfinyl group indicates that it contains a sulfur atom bonded to an oxygen atom, which can influence its reactivity and solubility. Additionally, the compound features a piperidine ring substituted with a 4-fluorobenzyl group, enhancing its lipophilicity and possibly its ability to cross biological membranes. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and effects would depend on its molecular conformation and the presence of functional groups that can engage in various chemical interactions.
Formula:C21H23FN2O3S
InChI:InChI=1/C21H23FN2O3S/c22-17-3-1-15(2-4-17)13-16-7-9-24(10-8-16)11-12-28(26)18-5-6-19-20(14-18)27-21(25)23-19/h1-6,14,16H,7-13H2,(H,23,25)
InChI key:InChIKey=FCBQJNCAKZSIAH-UHFFFAOYSA-N
SMILES:S(CCN1CCC(CC2=CC=C(F)C=C2)CC1)(=O)C=3C=C4C(=CC3)NC(=O)O4
Synonyms:- 2(3H)-benzoxazolone, 6-[[2-[4-[(4-fluorophenyl)methyl]-1-piperidinyl]ethyl]sulfinyl]-
- 6-[[2-[4-[(4-Fluorophenyl)methyl]-1-piperidinyl]ethyl]sulfinyl]-2(3H)-benzoxazolone
- Besonprodil
- Ci 1041
- Co 200461
- Pd 0196860
- Besonprodil (USAN)
- CHEMBL219631
- 6-({2-[4-(4-FLUOROBENZYL)PIPERIDIN-1-YL]ETHYL}SULFINYL)-1,3-BENZOXAZOL-2(3H)-ONE
- UNII-5K3N2D15WW
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Besonprodil
CAS:Besonprodil is a drug that acts as an NMDA antagonist and is selective for the NR2B subunit.Formula:C21H23FN2O3SColor and Shape:SolidMolecular weight:402.48
