CAS 253453-91-7
:2-Chloro-1-methyl-1H-imidazole
Description:
2-Chloro-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring structure, which includes a chlorine substituent and a methyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its role in various chemical syntheses and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances its reactivity, making it useful in nucleophilic substitution reactions. Additionally, the imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in biologically active compounds. The compound is soluble in polar organic solvents, and its stability can be influenced by environmental factors such as temperature and pH. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 2-Chloro-1-methyl-1H-imidazole is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C4H5ClN2
InChI:InChI=1/C4H5ClN2/c1-7-3-2-6-4(7)5/h2-3H,1H3
SMILES:Cn1ccnc1Cl
Synonyms:- 2-Chloro-1-methylimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloro-1-methylimidazole, 97+%
CAS:2-Chloro-1-methylimidazole is used in pharmaceuticals, drug candidates, ligands for transition metal catalysts and other molecular functional materials. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informationFormula:C4H5ClN2Purity:97+%Color and Shape:Colorless to pale brown, Liquid or viscous liquidMolecular weight:116.552-Chloro-1-methyl-1H-imidazole
CAS:Formula:C4H5ClN2Purity:96%Color and Shape:LiquidMolecular weight:116.54892-Chloro-1-methyl-1H-imidazole
CAS:2-Chloro-1-methyl-1H-imidazoleFormula:C4H5ClN2Purity:96%Color and Shape: yellow liquidMolecular weight:116.55g/mol2-Chloro-1-methyl-1H-imidazole
CAS:Formula:C4H5ClN2Purity:98%Color and Shape:LiquidMolecular weight:116.55






