CAS 25354-92-1
:2-Methylpentadecanoic acid
Description:
2-Methylpentadecanoic acid, also known as 2-methyl-15-pentadecanoic acid, is a long-chain saturated fatty acid characterized by a straight-chain structure with a methyl group located at the second carbon position. Its molecular formula is C16H32O2, indicating it contains 16 carbon atoms and two oxygen atoms. This fatty acid is typically found in certain natural fats and oils, contributing to their unique properties. It is a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. The presence of the methyl group influences its melting point and physical properties, making it distinct from other fatty acids. 2-Methylpentadecanoic acid is of interest in various fields, including biochemistry and nutrition, due to its potential effects on lipid metabolism and its role in the composition of certain dietary fats. Additionally, it may have applications in the synthesis of surfactants and other chemical products. As with many fatty acids, it is important to handle it with care, following appropriate safety guidelines.
Formula:C16H32O2
InChI:InChI=1S/C16H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16(17)18/h15H,3-14H2,1-2H3,(H,17,18)
InChI key:InChIKey=XEFOHUNTIRSZAC-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CC(C(O)=O)C
Synonyms:- Pentadecanoic acid, 2-methyl-
- 2-Methylpentadecanoic acid
- 2-Methylpentadecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
DL-α-Methylpentadecanoic acid
CAS:<p>DL-alpha-Methylpentadecanoic acid is a fine chemical that is useful as a scaffold, building block or reaction component. It is also a versatile building block for the synthesis of complex compounds. DL-alpha-Methylpentadecanoic acid can be used in research, as it has been shown to inhibit the activity of bacterial DNA gyrase and topoisomerase IV, which maintain the integrity of bacterial DNA. This compound can be used as an intermediate in the synthesis of speciality chemicals such as pesticides and pharmaceuticals.</p>Formula:C16H32O2Purity:Min. 91.0 Area-%Molecular weight:256.43 g/molDL-α-Methylpentadecanoic acid
CAS:DL-alpha-Methylpentadecanoic acid is a fatty acid that is metabolized in the body, and it is a component of many other lipids. The hydroxy group on DL-alpha-Methylpentadecanoic acid reacts with dobutamine to form a reaction solution. This reaction solution can be used to make angiography images of blood vessels in the heart. It has been shown that DL-alpha-Methylpentadecanoic acid inhibits insulin resistance by decreasing the uptake of glucose into cells and increasing insulin sensitivity. It also slows down stenosis caused by radiation or exposure to an inorganic acid such as nitric oxide, which is often used in chemotherapy.Formula:C16H32O2Purity:Min. 95%Color and Shape:PowderMolecular weight:256.42 g/mol

