CAS 25354-97-6: 2-Hexyldecanoic acid
Description:2-Hexyldecanoic acid, also known by its CAS number 25354-97-6, is a branched-chain fatty acid characterized by a long hydrocarbon chain. It features a total of 16 carbon atoms, with a carboxylic acid functional group (-COOH) at one end, which imparts acidic properties. The presence of the hexyldecyl group at the second carbon position distinguishes it from other fatty acids, contributing to its unique physical and chemical properties. This compound is typically a colorless to pale yellow liquid at room temperature and is insoluble in water due to its hydrophobic nature, while being soluble in organic solvents. 2-Hexyldecanoic acid is known for its applications in various fields, including cosmetics, lubricants, and as a surfactant in industrial processes. Its branched structure can enhance its performance in formulations, providing improved stability and viscosity. Additionally, it may exhibit antimicrobial properties, making it of interest in the development of preservatives and additives. Overall, 2-Hexyldecanoic acid is a versatile compound with significant industrial relevance.
Formula:C16H32O2
InChI:InChI=1S/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18)
InChI key:InChIKey=JMOLZNNXZPAGBH-UHFFFAOYSA-N
SMILES:O=C(O)C(CCCCCC)CCCCCCCC
- Synonyms:
- 2-n-Hexyldecanoic acid
- C<sub>16</sub> Guerbet fatty acid
- Decanoic acid, 2-hexyl-
- Fine Oxocol Isopalmitic Acid
- Hexyldecanoicacid
- Isocarb 16
- Isopalmitic acid
- 2-Hexyldecanoic acid
- C16 Guerbet fatty acid
