CAS 25357-95-3
:cis,cis-1,3,5-cyclohexanetricarboxylic acid
Description:
Cis,cis-1,3,5-cyclohexanetricarboxylic acid, also known as citric acid's structural isomer, is a cyclic tricarboxylic acid characterized by its three carboxylic acid functional groups attached to a cyclohexane ring. This compound exhibits a unique cis configuration, which influences its physical and chemical properties. It is typically a white crystalline solid that is soluble in water, reflecting its polar carboxylic acid groups. The presence of multiple carboxylic acid groups allows for strong hydrogen bonding, contributing to its solubility and reactivity. This compound can participate in various chemical reactions, including esterification and decarboxylation, making it of interest in organic synthesis and potential applications in biochemistry. Its structural features may also impart specific conformational properties, affecting its interactions with other molecules. While not as widely studied as citric acid, cis,cis-1,3,5-cyclohexanetricarboxylic acid serves as a valuable model for understanding the behavior of cyclic carboxylic acids in chemical and biological systems.
Formula:C9H12O6
InChI:InChI=1/C9H12O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5+,6-
Synonyms:- (1S,3S,5S)-Cyclohexane-1,3,5-Tricarboxylic Acid
- Cis-1,3,5-Cyclohexanetricarboxylic Acid
- (1α,3α,5α)-1,3,5-Cyclohexanetricarboxylic acid
- (1ALPHA,3ALPHA,5ALPHA)-1,3,5-Cyclohexanetricarboxylic acid
- 1,3,5-Cyclohexanetricarboxylic acid, (1.alpha.,3.alpha.,5.alpha.)-
- 1,3,5-Cyclohexanetricarboxylic acid
- 1,3,5-Cyclohexanecarboxylicacid
- Nsc 409575
- 1,3,5-Cyclohexanetricarboxylicacid
- 1,3,5-Cyclohexane tricarboxylic aicd
- Cyclohexane-1,3,5-Tricarboxylic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,5-Cyclohexanetricarboxylic Acid (cis- and trans- mixture)
CAS:Formula:C9H12O6Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:216.19Cyclohexane-1,3,5-tricarboxylic acid
CAS:Formula:C9H12O6Purity:98%Color and Shape:SolidMolecular weight:216.1880Cyclohexane-1,3,5-Tricarboxylic Acid
CAS:Cyclohexane-1,3,5-Tricarboxylic AcidPurity:98%Molecular weight:216.19g/mol



