CAS 2536-88-1

1,2,3-benzotriazine-4(1H)-thione

Description:

1,2,3-Benzotriazine-4(1H)-thione, with the CAS number 2536-88-1, is a heterocyclic compound characterized by a benzotriazine core structure that incorporates a thione functional group. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in various fields, including pharmaceuticals and materials science. The thione group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. Additionally, 1,2,3-benzotriazine-4(1H)-thione may exhibit interesting photochemical properties, making it a subject of study in photochemistry. Its solubility can vary depending on the solvent, and it may show moderate stability under standard conditions, although it is sensitive to light and moisture. The compound's unique structure and properties make it a valuable candidate for further research in synthetic chemistry and potential applications in drug development or as a chemical intermediate.

Formula: C₇H₅N₃S

InChI: InChI=1/C7H5N3S/c11-7-5-3-1-2-4-6(5)8-10-9-7/h1-4H,(H,8,9,11)

SMILES: c1ccc2c(c1)c(nnn2)S

Synonyms:

• 1,2,3-benzotriazine-4(3H)-thione
• 1,2,3-Benzotriazine-4-Thiol

1,2,3-Benzotriazine-4-thiol

CAS: 2536-88-1

Versatile small molecule scaffold

Formula: C₇H₅N₃S

Purity: Min. 95%

Molecular weight: 163.2 g/mol

Ref: 3D-CAA53688