CAS 25364-43-6
:1-(m-Tolyl)imidazole
Description:
1-(m-Tolyl)imidazole, with the CAS number 25364-43-6, is an organic compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the m-tolyl group, a methyl-substituted phenyl group, contributes to its unique properties, including its hydrophobic character and potential for various interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often studied for its potential applications in pharmaceuticals, particularly as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. The imidazole moiety is known for its role in biological systems, particularly in the structure of amino acids like histidine, and can participate in hydrogen bonding and coordination with metal ions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H10N2
InChI:InChI=1/C10H10N2/c1-9-3-2-4-10(7-9)12-6-5-11-8-12/h2-8H,1H3
SMILES:Cc1cccc(c1)n1ccnc1
Synonyms:- 1-(3-methylphenyl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
