CAS 25369-43-1
:2-oxo-2,3-dihydro-1H-indole-7-carboxylic acid
Description:
2-Oxo-2,3-dihydro-1H-indole-7-carboxylic acid, with the CAS number 25369-43-1, is a chemical compound that features a bicyclic indole structure. This compound is characterized by the presence of a carboxylic acid functional group and a ketone group, contributing to its reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in polar solvents, which is common for compounds containing carboxylic acids. The indole moiety is known for its role in various biological processes and can serve as a scaffold for drug development. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques like NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 2-oxo-2,3-dihydro-1H-indole-7-carboxylic acid is a valuable compound in both research and potential therapeutic applications.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c11-7-4-5-2-1-3-6(9(12)13)8(5)10-7/h1-3H,4H2,(H,10,11)(H,12,13)
SMILES:c1cc2CC(=Nc2c(c1)C(=O)O)O
Synonyms:- 2-Oxo-Indoline-7-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Oxoindoline-7-carboxylic acid
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.15682-Oxoindoline-7-carboxylic acid
CAS:2-Oxoindoline-7-carboxylic acidPurity:98%Molecular weight:177.16g/mol2-OXO-INDOLINE-7-CARBOXYLIC ACID
CAS:Formula:C9H7NO3Purity:95%Color and Shape:SolidMolecular weight:177.1592-oxo-Indoline-7-carboxylic acid
CAS:2-Oxo-indoline-7-carboxylic acid is an antiinflammatory agent that belongs to the class of hydrazines. It has been shown to have antiinflammatory activity in stepwise manner, which starts with a hydrazine group attacking the carbonyl group of a carboxylic acid and forming a new heterocyclic ring. 2-Oxo-indoline-7-carboxylic acid also has esterase inhibitory effect and can be used for the treatment of inflammatory diseases such as rheumatoid arthritis.
Formula:C9H7NO3Purity:Min. 95%Molecular weight:177.16 g/mol



