CAS 2537-91-9
:N-[(benzyloxy)carbonyl]phenylalanyltyrosine
Description:
N-[(benzyloxy)carbonyl]phenylalanyltyrosine, also known by its CAS number 2537-91-9, is a synthetic peptide derivative that features a combination of amino acids and protective groups. This compound is characterized by the presence of a phenylalanine and tyrosine residue, which are both aromatic amino acids, contributing to its hydrophobic properties. The benzyloxycarbonyl (Z) group serves as a protective moiety for the amino group of phenylalanine, enhancing the stability and solubility of the peptide in organic solvents. The structure allows for potential applications in peptide synthesis and drug development, particularly in the design of bioactive compounds. Additionally, the presence of the aromatic side chains may facilitate interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis typically involves standard peptide coupling techniques, and it may be used in research related to protein structure and function, as well as in the development of therapeutic agents.
Formula:C26H26N2O6
InChI:InChI=1/C26H26N2O6/c29-21-13-11-19(12-14-21)16-23(25(31)32)27-24(30)22(15-18-7-3-1-4-8-18)28-26(33)34-17-20-9-5-2-6-10-20/h1-14,22-23,29H,15-17H2,(H,27,30)(H,28,33)(H,31,32)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Z-Phe-Tyr
CAS:Z-Phe-Tyr is a potent irreversible inhibitor of serine proteases. It binds to the active site of the enzyme and prevents it from performing its function, which is to cleave proteins at specific sites. Z-Phe-Tyr has been shown to be effective against inflammatory bowel disease, but not against other types of diseases such as diabetes mellitus or rheumatoid arthritis. The drug inhibits protease activity and can be used in experimental models to study the molecular mechanisms of inflammation and inflammatory diseases.Formula:C26H26N2O6Purity:Min. 95%Molecular weight:462.49 g/mol
