CAS 25370-46-1
:ethyl 4-oxo-4-pyridin-4-ylbutanoate
Description:
Ethyl 4-oxo-4-pyridin-4-ylbutanoate, with the CAS number 25370-46-1, is an organic compound characterized by its ester functional group and a pyridine ring. This compound features a butanoate backbone, which contributes to its structural complexity. The presence of the 4-oxo group indicates that it contains a carbonyl functional group (C=O) adjacent to the pyridine ring, which can influence its reactivity and stability. Ethyl 4-oxo-4-pyridin-4-ylbutanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, including synthesis in medicinal chemistry and as an intermediate in the production of pharmaceuticals. The compound may exhibit biological activity due to the presence of the pyridine moiety, which is often associated with various pharmacological properties. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-2-15-11(14)4-3-10(13)9-5-7-12-8-6-9/h5-8H,2-4H2,1H3
SMILES:CCOC(=O)CCC(=O)c1ccncc1
Synonyms:- 4-Oxo-4-pyridin-4-yl-butyric acid ethyl ester
- γ-oxo-4-Pyridinebutanoic Acid Ethyl Estee
- γ-Oxo-4-pyridinebutyric Acid Ethyl Ester
- 4-Pyridinebutanoic acid, γ-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.