CAS 25372-42-3: 1-(3-fluorophenyl)-1H-imidazole

Description:1-(3-Fluorophenyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position relative to the imidazole. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the aromatic and heterocyclic components. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing nature of the fluorine atom. Additionally, compounds like this one are often studied for their biological activities, including potential pharmaceutical applications, as imidazole derivatives are known for their roles in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.

Formula:C₉H₇FN₂

InChI:InChI=1/C9H7FN2/c10-8-2-1-3-9(6-8)12-5-4-11-7-12/h1-7H

Synonyms:
1H-Imidazole, 1-(3-fluorophenyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(3-Fluorophenyl)imidazole REF: 10-F002570CAS: 25372-42-3	98.0%	94.00 €	Mon 14 Apr 25
1-(3-FLUOROPHENYL)IMIDAZOLE REF: IN-DA00BFJFCAS: 25372-42-3	- - -	To inquire	Wed 16 Apr 25
1-(3-Fluorophenyl)imidazole REF: 54-PC4158ECAS: 25372-42-3	By gc: 98.78% (Typical Value in Batch COA)	54.00 €~107.00 €	Wed 23 Apr 25
1-(3-Fluorophenyl)-1H-Imidazole REF: 3D-FF79969CAS: 25372-42-3	Min. 95%	- - -	Discontinued product