CymitQuimica logo

CAS 25373-69-7

:

2,6-dibromopyridine 1-oxide

Description:
2,6-Dibromopyridine 1-oxide is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms at the 2 and 6 positions and a nitrogen-oxide functional group at the 1 position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state. It is known for its moderate solubility in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The nitrogen-oxide group can also impart unique properties, such as potential antioxidant activity. Safety considerations include handling it with care due to its potential toxicity and environmental impact. Overall, 2,6-dibromopyridine 1-oxide is a valuable compound in organic chemistry with diverse applications, though proper safety protocols should be observed during its use.
Formula:C5H3Br2NO
InChI:InChI=1/C5H3Br2NO/c6-4-2-1-3-5(7)8(4)9/h1-3H
InChI key:YOJAFCXACCYASM-UHFFFAOYSA-N
SMILES:c1cc(Br)n(=O)c(c1)Br
Synonyms:
  • 2,6-Dibromopyridine oxide
  • 2,6-Dibromopyridine-1-oxyde
  • 2,6-Dibrompyridin-1-oxid
Found 5 products.