
CAS 25383-99-7
:Sodium stearoyl lactylate
Description:
Sodium stearoyl lactylate is a chemical compound that serves primarily as an emulsifier and surfactant in various applications, particularly in the food and cosmetic industries. It is a sodium salt derived from the reaction of stearic acid and lactic acid, which contributes to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic substances. This compound is known for its ability to improve the texture and stability of formulations, enhancing the incorporation of air into products and promoting uniformity. In food applications, it is often used in baked goods to improve dough handling and extend shelf life. Additionally, sodium stearoyl lactylate is recognized for its skin-conditioning properties in cosmetic formulations, making it a valuable ingredient in lotions and creams. It is generally regarded as safe for use, although, like many additives, it should be used within established regulatory limits. Its versatility and effectiveness make it a popular choice in both food technology and personal care products.
Formula:C24H44O6·Na
InChI:InChI=1S/C24H44O6.Na/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)29-21(3)24(28)30-20(2)23(26)27;/h20-21H,4-19H2,1-3H3,(H,26,27);
InChI key:InChIKey=OXXZDFRVEHURLA-UHFFFAOYSA-N
SMILES:O(C(C(OC(C(O)=O)C)=O)C)C(CCCCCCCCCCCCCCCCC)=O.[Na]
Synonyms:- Octadecanoic acid, 2-(1-carboxyethoxy)-1-methyl-2-oxoethyl ester, sodium salt
- Stearic acid, ester with lactic acid bimol. ester, sodium salt
- Octadecanoic acid, 2-(1-carboxyethoxy)-1-methyl-2-oxoethyl ester, sodium salt (1:1)
- Emplex
- Lactic acid, bimol. ester, stearate, sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Octadecanoic acid,2-(1-carboxyethoxy)-1-methyl-2-oxoethyl ester, sodium salt (1:1)
CAS:Formula:C24H43NaO6Purity:97%Color and Shape:SolidMolecular weight:450.5844Sodium stearoyl lactylate
CAS:Sodium stearoyl lactylateFormula:C24H43O6·NaPurity:97%Color and Shape: whte solidMolecular weight:450.58g/molSodium 2-((2-(stearoyloxy)propanoyl)oxy)propanoate
CAS:Sodium 2-((2-(stearoyloxy)propanoyl)oxy)propanoate is a sodium salt that has been used as a model system for the study of acidic ester linkages. It can also be used as a diagnostic agent to measure the concentration of fatty acids in biological fluids. The molecule contains two stearoyl chains, which are glycol esters with an emulsifier, and four fatty acids, which are surfactants. The molecule also contains two sodium ions, which are complex enzymes.Formula:C24H43NaO6Purity:Min. 95%Molecular weight:450.58 g/mol



