CymitQuimica logo

CAS 253870-02-9

:

5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid

Description:
5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a formyl group (-CHO) and a carboxylic acid group (-COOH) attached to the pyrrole ring, along with two methyl groups at the 2 and 4 positions. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is likely to exhibit properties typical of pyrrole derivatives, such as being a weak acid due to the carboxylic acid group and showing potential for hydrogen bonding due to the presence of both the formyl and carboxylic acid functionalities. Additionally, its structure may allow for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. As with many organic compounds, its solubility, stability, and reactivity can be influenced by the specific conditions under which it is handled.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-4-6(3-10)9-5(2)7(4)8(11)12/h3,9H,1-2H3,(H,11,12)
InChI key:InChIKey=YCIHQDVIAISDPS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C)=C(C=O)NC1C
Synonyms:
  • 5-Formyl-2,4-dimethylpyrrole-3-carboxylic acid
  • 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid
  • 2,4-Dimethyl-5-formylpyrrole-3-carboxylic acid
  • 1H-Pyrrole-3-carboxylic acid, 5-formyl-2,4-dimethyl-
  • 2,4-Dimethyl-5-formyl-1H-pyrrole-3-carboxylic acid
Found 12 products.