CAS 25391-66-6

5-iodopyridin-3-amine

Description:

5-Iodopyridin-3-amine is an organic compound characterized by the presence of an iodine atom and an amino group attached to a pyridine ring. The molecular structure features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The iodine substituent is located at the 5-position, while the amino group is positioned at the 3-position of the pyridine ring. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in polar solvents, depending on the specific conditions. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in the synthesis of pharmaceuticals and agrochemicals. The presence of both the iodine and amino functional groups can influence its reactivity, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as iodine can be hazardous, and proper storage conditions should be observed to maintain its stability.

Formula: C₅H₅IN₂

InChI: InChI=1/C5H5IN2/c6-4-1-5(7)3-8-2-4/h1-3H,7H2

SMILES: c1c(cncc1N)I

Synonyms:

• 3-Pyridinamine, 5-Iodo-

5-Iodo-pyridin-3-ylamine

CAS: 25391-66-6

Formula: C₅H₅IN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.0111

Ref: IN-DA003MTC

3-Amino-5-iodopyridine

CAS: 25391-66-6

3-Amino-5-iodopyridine

Purity: ≥95%

Molecular weight: 220.01g/mol

Ref: 54-OR345311

5-Iodopyridin-3-amine

CAS: 25391-66-6

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.0130005

Ref: 10-F921199

3-Amino-5-iodo-pyridine

Controlled Product

CAS: 25391-66-6

Formula: C₅H₅IN₂

Color and Shape: Neat

Molecular weight: 220.011

Ref: TR-A611035