CAS 25433-13-0
:1-methyl-5-phenyl-1,3-dihydro-2H-imidazole-2-thione
Description:
1-Methyl-5-phenyl-1,3-dihydro-2H-imidazole-2-thione, with the CAS number 25433-13-0, is a heterocyclic compound characterized by its imidazole ring structure, which contains both sulfur and nitrogen atoms. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential reactivity. The presence of the thione functional group (–C=S) indicates that it may exhibit properties similar to thiols, such as potential nucleophilicity and the ability to participate in various chemical reactions, including those involving electrophiles. The imidazole ring is known for its role in biological systems, particularly in the structure of amino acids and enzymes, suggesting that derivatives of this compound could have biological significance. Additionally, the compound may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 1-methyl-5-phenyl-1,3-dihydro-2H-imidazole-2-thione presents interesting avenues for research in both synthetic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C10H10N2S
InChI:InChI=1/C10H10N2S/c1-12-9(7-11-10(12)13)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,13)
SMILES:Cn1c(cnc1S)c1ccccc1
Synonyms:- 1H-imidazole-2-thiol, 1-methyl-5-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Methyl-5-phenyl-1H-imidazole-2-thiol
CAS:1-Methyl-5-phenyl-1H-imidazole-2-thiolPurity:95%Molecular weight:190.26g/mol1-Methyl-5-phenyl-1h-imidazole-2-thiol
CAS:1-Methyl-5-phenyl-1H-imidazole-2-thiol (1MPHT) is an experimental drug that has been shown to be an active inhibitor of the enzyme protein kinase C delta (PKCδ). PKCδ is a serine/threonine kinase that is involved in inflammatory bowel disease and hepatic steatosis. 1MPHT has also been shown to inhibit dextran sulfate, a molecule that activates Toll-like receptor 4 (TLR4), which plays a role in the pathogenesis of inflammatory bowel disease. More research needs to be done to determine the effects of 1MPHT on cancer cell viability.Formula:C10H10N2SPurity:Min. 95%Molecular weight:190.27 g/mol


