CAS 2544-06-1
:3-methoxypropionic acid
Description:
3-Methoxypropionic acid is an organic compound characterized by the presence of a carboxylic acid functional group and a methoxy group attached to a three-carbon chain. Its molecular formula is C4H8O3, indicating it contains four carbon atoms, eight hydrogen atoms, and three oxygen atoms. This compound typically appears as a colorless to pale yellow liquid with a slightly sweet odor. It is soluble in water and polar organic solvents, which enhances its utility in various chemical applications. 3-Methoxypropionic acid is known for its role as a building block in organic synthesis, particularly in the production of esters and other derivatives. Additionally, it can serve as a solvent or intermediate in the manufacture of pharmaceuticals, agrochemicals, and other fine chemicals. The compound's properties, such as boiling point and acidity, make it relevant in both industrial and laboratory settings. As with many organic acids, it should be handled with care due to potential irritant effects on skin and mucous membranes.
Formula:C4H8O3
InChI:InChI=1/C4H8O3/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)
SMILES:COCCC(=O)O
Synonyms:- 3-Methoxypropionicacid
- 3-Methoxypropanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Methoxypropanoic Acid
CAS:Formula:C4H8O3Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:104.113-Methoxypropanoic acid
CAS:3-Methoxypropanoic acid contains a carboxyl group and a methoxy group, widely used in biochemical experiments and drug synthesis research.Formula:C4H8O3Color and Shape:SolidMolecular weight:104.13-Methoxypropanoic acid
CAS:3-Methoxypropanoic acidFormula:C4H8O3Purity:98%Color and Shape: colourless liquidMolecular weight:104.10g/mol3-Methoxypropanoic Acid
CAS:<p>Applications 3-Methoxypropanoic acid<br></p>Formula:C4H8O3Color and Shape:NeatMolecular weight:104.11m-PEG1-acid
CAS:<p>M-PEG1-acid, a soluble PEG derivative, has a terminal carboxylic acid for forming amide bonds with primary amines using activators like EDC, DCC.</p>Formula:C4H8O3Purity:98%Color and Shape:SolidMolecular weight:104.10






