CAS 25440-14-6: 5,10,15,20-tetrakis(pentafluorophenyl)porphyrin
Description:5,10,15,20-Tetrakis(pentafluorophenyl)porphyrin is a synthetic porphyrin compound characterized by its complex structure, which includes a porphyrin core substituted with four pentafluorophenyl groups. This substitution significantly enhances its electron-withdrawing properties, making it a strong candidate for applications in photodynamic therapy, sensors, and as a catalyst in various chemical reactions. The presence of fluorine atoms contributes to its stability and solubility in organic solvents, while also imparting unique optical properties, such as strong absorption in the visible region of the electromagnetic spectrum. The compound typically exhibits a deep color, often appearing as a vivid purple or red solution. Its high thermal and chemical stability allows it to withstand harsh conditions, making it suitable for various industrial and research applications. Additionally, the presence of multiple fluorinated groups can influence its interactions with biological systems, potentially enhancing its efficacy in targeted therapies. Overall, 5,10,15,20-tetrakis(pentafluorophenyl)porphyrin is a versatile compound with significant implications in both materials science and medicinal chemistry.
Formula:C44H10F20N4
InChI:InChI=1/C44H10F20N4/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-1-2-10(65-9)18(22-27(47)35(55)42(62)36(56)28(22)48)12-5-6-14(67-12)20(24-31(51)39(59)44(64)40(60)32(24)52)16-8-7-15(68-16)19(13-4-3-11(17)66-13)23-29(49)37(57)43(63)38(58)30(23)50/h1-8,65,68H/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+