CAS 254429-83-9

2-[4-(1,2,3-thiadiazol-4-yl)phenyl]ethanethioamide

Description:

2-[4-(1,2,3-thiadiazol-4-yl)phenyl]ethanethioamide, with the CAS number 254429-83-9, is a chemical compound characterized by its unique structure that includes a thiadiazole ring and an ethanethioamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. The presence of the thiadiazole moiety suggests potential biological activity, as many thiadiazole derivatives are known for their pharmacological properties. The compound is likely to be soluble in organic solvents, and its stability may vary depending on environmental conditions such as pH and temperature. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the presence of the thiol group. Overall, the characteristics of this compound make it of interest in fields such as medicinal chemistry and materials science, where its unique structural features can be leveraged for the development of new therapeutic agents or functional materials.

Formula: C₁₀H₉N₃S₂

InChI: InChI=1/C10H9N3S2/c11-10(14)5-7-1-3-8(4-2-7)9-6-15-13-12-9/h1-4,6H,5H2,(H2,11,14)

SMILES: c1cc(ccc1CC(=N)S)c1csnn1

2-[4-(1,2,3-Thiadiazol-4-yl)phenyl]thioacetamide

CAS: 254429-83-9

2-[4-(1,2,3-Thiadiazol-4-yl)phenyl]thioacetamide

Purity: ≥95%

Molecular weight: 235.33g/mol

Ref: 54-OR29061