CAS 25452-22-6
:2-[(2-fluorobenzyl)amino]-2-methylpropan-1-ol
Description:
2-[(2-Fluorobenzyl)amino]-2-methylpropan-1-ol, with the CAS number 25452-22-6, is an organic compound characterized by its amine and alcohol functional groups. This substance features a secondary amine due to the presence of the fluorobenzyl group attached to a carbon that also bears a hydroxyl (-OH) group, contributing to its classification as an alcohol. The molecular structure includes a branched alkyl chain, specifically a 2-methylpropan-1-ol backbone, which enhances its steric properties. The presence of the fluorine atom in the benzyl group can influence the compound's reactivity and polarity, potentially affecting its solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its characteristics, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.
Formula:C11H16FNO
InChI:InChI=1/C11H16FNO/c1-11(2,8-14)13-7-9-5-3-4-6-10(9)12/h3-6,13-14H,7-8H2,1-2H3
SMILES:CC(C)(CO)NCc1ccccc1F
Synonyms:- 1-Propanol, 2-[[(2-Fluorophenyl)Methyl]Amino]-2-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.