CAS 25459-12-5
:1-[2-(ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole
Description:
1-[2-(Ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethylsulfonyl group, which enhances its solubility and reactivity, and a nitro group that contributes to its potential biological activity. The presence of the methyl group on the imidazole ring can influence its electronic properties and steric hindrance. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive agent. Its structure suggests that it may exhibit various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the sulfonyl group may impart unique properties such as increased polarity and the ability to form hydrogen bonds, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features contribute to its potential applications in drug development and other chemical research areas.
Formula:C8H13N3O4S
InChI:InChI=1/C8H13N3O4S/c1-3-16(14,15)5-4-10-6-8(11(12)13)9-7(10)2/h6H,3-5H2,1-2H3
SMILES:CCS(=O)(=O)CCn1cc(nc1C)N(=O)=O
Synonyms:- Imidazole, 1-(2-(Ethylsulfonyl)Ethyl)-2-Methyl-4-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 6 products.
Tinidazole Related Compound B (1-(2-ethyl-sulfonylethyl)-2-methyl-4-nitroimidazole)
CAS:Compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure nesoiFormula:C8H13N3O4SColor and Shape:Off-White Cream PowderMolecular weight:247.062681-[2-(Ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole
CAS:Controlled ProductFormula:C8H13N3O4SColor and Shape:NeatMolecular weight:247.274-Nitro-5-desnitro Tinidazole
CAS:Controlled ProductImpurity Tinidazole EP Impurity B
Applications 4-Nitro-5-desnitro Tinidazole (Tinidazole EP Impurity B) is an impurity in the synthesis of Tinidazole (T443900), antiprotozoal (Trichomonas, Giardia); antiamebic; antibacterial.
References Miller, M.W., et al.: J. Med. Chem., 13, 849 (1970), Oderdea, G., et al.: Gut, 33, 1328 (1992),Formula:C8H13N3O4SColor and Shape:NeatMolecular weight:247.27






