CAS 25459-12-5

1-[2-(ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole

Description:

1-[2-(Ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethylsulfonyl group, which enhances its solubility and reactivity, and a nitro group that contributes to its potential biological activity. The presence of the methyl group on the imidazole ring can influence its electronic properties and steric hindrance. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive agent. Its structure suggests that it may exhibit various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the sulfonyl group may impart unique properties such as increased polarity and the ability to form hydrogen bonds, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features contribute to its potential applications in drug development and other chemical research areas.

Formula: C₈H₁₃N₃O₄S

InChI: InChI=1/C8H13N3O4S/c1-3-16(14,15)5-4-10-6-8(11(12)13)9-7(10)2/h6H,3-5H2,1-2H3

SMILES: CCS(=O)(=O)CCn1cc(nc1C)N(=O)=O

Synonyms:

• Imidazole, 1-(2-(Ethylsulfonyl)Ethyl)-2-Methyl-4-Nitro-

TINIDAZOLE IMPURITY B CRS

CAS: 25459-12-5

TINIDAZOLE IMPURITY B CRS

Formula: C₈H₁₃N₃O₄S

Molecular weight: 247.2715

Ref: 41-T1471000

Tinidazole Related Compound B (1-(2-ethyl-sulfonylethyl)-2-methyl-4-nitroimidazole)

CAS: 25459-12-5

Compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure nesoi

Formula: C₈H₁₃N₃O₄S

Color and Shape: Off-White Cream Powder

Molecular weight: 247.28

Ref: 45-1667541

Tinidazole EP Impurity B

CAS: 25459-12-5

Formula: C₈H₁₃N₃O₄S

Molecular weight: 247.27

Ref: 4Z-T-867

1-[2-(Ethylsulfonyl)ethyl]-2-methyl-4-nitro-1H-imidazole

Controlled Product

CAS: 25459-12-5

Formula: C₈H₁₃N₃O₄S

Color and Shape: Neat

Molecular weight: 247.27

Ref: 86-MM0151.02

4-Nitro-5-desnitro Tinidazole

Controlled Product

CAS: 25459-12-5

Impurity Tinidazole EP Impurity B
Applications 4-Nitro-5-desnitro Tinidazole (Tinidazole EP Impurity B) is an impurity in the synthesis of Tinidazole (T443900), antiprotozoal (Trichomonas, Giardia); antiamebic; antibacterial.
References Miller, M.W., et al.: J. Med. Chem., 13, 849 (1970), Oderdea, G., et al.: Gut, 33, 1328 (1992),

Formula: C₈H₁₃N₃O₄S

Color and Shape: Neat

Molecular weight: 247.27

Ref: TR-N493785

Tinidazole EP Impurity B

CAS: 25459-12-5

Formula: C₈H₁₃N₃O₄S

Molecular weight: 247.27

Ref: ST-EA-CP-T46002