CymitQuimica logo

CAS 25460-87-1

:

Ac-Glu-NH2

Description:
The chemical substance known as Ac-Glu-NH2, with the CAS number 25460-87-1, is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features an acetyl group (Ac) attached to the amino group of glutamic acid, which enhances its stability and solubility. Ac-Glu-NH2 is characterized by its ability to participate in peptide synthesis and is often utilized in biochemical research and pharmaceutical applications. It exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in ionic interactions, which are essential for its biological activity. Additionally, the acetylation modifies its reactivity and can influence its interaction with enzymes and receptors. Overall, Ac-Glu-NH2 serves as an important building block in the synthesis of peptides and proteins, contributing to various physiological functions and potential therapeutic applications.
Formula:C7H12N2O4
InChI:InChI=1S/C7H12N2O4/c1-4(10)9-5(7(8)13)2-3-6(11)12/h5H,2-3H2,1H3,(H2,8,13)(H,9,10)(H,11,12)/t5-/m0/s1
InChI key:ZAFUMUJQGCBVPX-YFKPBYRVSA-N
SMILES:CC(=O)N[C@@H](CCC(=O)O)C(=O)N
Found 3 products.