CAS 25461-00-1

na-T-boc-ethylmercapto-L-cysteine*dicyclohexylamm

Description:

Na-T-Boc-ethylmercapto-L-cysteine, with the CAS number 25461-00-1, is a derivative of the amino acid cysteine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and an ethylmercapto functional group. This compound is typically used in peptide synthesis and bioconjugation due to its ability to protect the thiol group of cysteine, which can be reactive in various chemical environments. The dicyclohexylammonium (DCHA) salt form enhances its solubility and stability in organic solvents, making it suitable for various synthetic applications. The presence of the mercapto group allows for potential redox reactions and the formation of disulfide bonds, which are crucial in protein folding and stability. Additionally, the compound's structure contributes to its role in biochemical research, particularly in studies involving protein interactions and modifications. Overall, Na-T-Boc-ethylmercapto-L-cysteine is a valuable reagent in organic and medicinal chemistry, facilitating the synthesis of complex molecules.

Formula: C₂₂H₄₂N₂O₄S₂

InChI: InChI=1/C12H23N.C10H19NO4S2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-16-17-6-7(8(12)13)11-9(14)15-10(2,3)4/h11-13H,1-10H2;7H,5-6H2,1-4H3,(H,11,14)(H,12,13)

SMILES: C1CCC(CC1)NC1CCCCC1.CCSSCC(C(=O)O)N=C(O)OC(C)(C)C

Synonyms:

• N-(tert-butoxycarbonyl)-3-(ethyldisulfanyl)alanine - N-cyclohexylcyclohexanamine (1:1)
• N-Alpha-T-Boc-Ethylmercapto-L-Cysteine Dicyclohexylammonium Salt

Boc-Cys(SEt)-OH·DCHA

Controlled Product

CAS: 25461-00-1

Please enquire for more information about Boc-Cys(SEt)-OH·DCHA including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₉NO₄S₂·C₁₂H₂₃N

Purity: Min. 95%

Color and Shape: White/Off-White Solid

Molecular weight: 462.71

Ref: 3D-FB111210