CAS 25462-85-5
:2-Chloro-6-methylpyridine-4-carboxylic acid
Description:
2-Chloro-6-methylpyridine-4-carboxylic acid is an organic compound characterized by its pyridine ring structure, which includes a chlorine atom and a carboxylic acid functional group. This compound features a chlorine substituent at the 2-position and a methyl group at the 6-position of the pyridine ring, while the carboxylic acid group is located at the 4-position. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its unique structure makes it useful in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the chlorine atom can influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11)
SMILES:Cc1cc(cc(Cl)n1)C(=O)O
Synonyms:- 2-Chloro-6-methyl-4-pyridinecarboxylic acid
- 2-Chloro-6-methylisonicotinic acid
- 4-Pyridinecarboxylic acid, 2-chloro-6-methyl-
- T6Nj Bg Dvq F1 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-6-methylisonicotinic acid
CAS:Formula:C7H6ClNO2Purity:98%Color and Shape:SolidMolecular weight:171.58102-Chloro-6-methylpyridine-4-carboxylic acid
CAS:Formula:C7H6ClNO2Purity:≥ 97.5%Color and Shape:White to pale yellow or pale brown crystals or powderMolecular weight:171.582-Chloro-6-methylisonicotinic Acid
CAS:Formula:C7H6ClNO2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:171.582-Chloro-6-methylisonicotinic acid
CAS:2-Chloro-6-methylisonicotinic acidFormula:C7H6ClNO2Purity:98%Color and Shape: grey-green solidMolecular weight:171.58g/mol2-Chloro-6-methylpyridine-4-carboxylic acid,
CAS:Formula:C7H6ClNO2Purity:96%Color and Shape:SolidMolecular weight:171.58




