CAS 25468-53-5
:ethyl 2-cyano-3-ethoxypent-2-enoate
Description:
Ethyl 2-cyano-3-ethoxypent-2-enoate is an organic compound characterized by its functional groups, including a cyano group (-CN) and an ethoxy group (-OCH2CH3), which contribute to its reactivity and properties. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It has a relatively low boiling point compared to larger organic molecules, making it suitable for various synthetic applications. Ethyl 2-cyano-3-ethoxypent-2-enoate is often utilized in organic synthesis, particularly in the production of other chemical compounds through reactions such as nucleophilic addition or condensation. Its structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C10H15NO3
InChI:InChI=1/C10H15NO3/c1-4-9(13-5-2)8(7-11)10(12)14-6-3/h4-6H2,1-3H3
SMILES:CCC(=C(C#N)C(=O)OCC)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.