CymitQuimica logo

CAS 254732-51-9

:

2-Chloro-3-(trifluoromethyl)quinoxaline

Description:
2-Chloro-3-(trifluoromethyl)quinoxaline is a heterocyclic compound characterized by its quinoxaline backbone, which consists of two fused aromatic rings containing nitrogen atoms. The presence of a chloro group at the second position and a trifluoromethyl group at the third position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it an attractive moiety in drug design. Additionally, the chlorine atom can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Chloro-3-(trifluoromethyl)quinoxaline is a valuable compound in research and development within the fields of chemistry and pharmacology.
Formula:C9H4ClF3N2
InChI:InChI=1S/C9H4ClF3N2/c10-8-7(9(11,12)13)14-5-3-1-2-4-6(5)15-8/h1-4H
InChI key:InChIKey=DSMMAQWRRJQVTQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC2=C(N=C1Cl)C=CC=C2
Synonyms:
  • 2-Chloro-3-(trifluoromethyl)quinoxaline
  • Quinoxaline, 2-chloro-3-(trifluoromethyl)-
Found 5 products.