CymitQuimica logo

CAS 2548-85-8

:

4,8,12,15,19-Docosapentaenoic acid

Description:
4,8,12,15,19-Docosapentaenoic acid, commonly referred to as DPA, is a polyunsaturated fatty acid belonging to the omega-3 family. It is characterized by a long carbon chain consisting of 22 carbon atoms and five double bonds, which are positioned at specific intervals along the chain. This structure contributes to its fluidity and reactivity, making it an important component in biological membranes. DPA is found in various marine oils and is known for its potential health benefits, including anti-inflammatory properties and cardiovascular health support. It plays a role in the synthesis of eicosanoids, which are signaling molecules that influence numerous physiological processes. DPA can be metabolized into other omega-3 fatty acids, such as DHA (docosahexaenoic acid), further emphasizing its significance in human nutrition. Additionally, it is studied for its potential role in brain health and development. As a fatty acid, it is typically present in triglyceride form in dietary sources and can be obtained through the consumption of fish and certain algae.
Formula:C22H34O2
InChI:InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,7-8,10-11,14-15,18-19H,2,5-6,9,12-13,16-17,20-21H2,1H3,(H,23,24)
InChI key:InChIKey=PIFPCDRPHCQLSJ-UHFFFAOYSA-N
SMILES:C(=CCCC=CCC=CCCC=CCC)CCC=CCCC(O)=O
Synonyms:
  • (4E,8E,12E,15E,19E)-docosa-4,8,12,15,19-pentaenoic acid
  • 4,8,12,15,19-Docosapentaenoic acid
  • Docosa-4,8,12,15,19-pentaenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.