
CAS 25488-53-3
:Dihydrobetulinic acid
Description:
Dihydrobetulinic acid is a pentacyclic triterpenoid compound derived from betulinic acid, which is found in the bark of birch trees. It is characterized by its molecular structure, which includes a cyclopentanoperhydrophenanthrene skeleton, contributing to its biological activity. This compound is known for its potential therapeutic properties, including anti-inflammatory, antiviral, and anticancer effects. Dihydrobetulinic acid exhibits moderate solubility in organic solvents and limited solubility in water, which can influence its bioavailability and pharmacokinetics. Its mechanism of action often involves the induction of apoptosis in cancer cells and modulation of various signaling pathways. Additionally, research into its derivatives and analogs is ongoing to enhance its efficacy and reduce potential side effects. As with many natural products, the extraction and purification processes can affect the yield and purity of dihydrobetulinic acid, making it essential for studies to utilize standardized methods for analysis. Overall, dihydrobetulinic acid represents a promising area of study in medicinal chemistry and natural product research.
Formula:C30H50O3
InChI:InChI=1S/C30H50O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h18-24,31H,8-17H2,1-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=PZXJOHSZQAEJFE-FZFNOLFKSA-N
SMILES:C(O)(=O)[C@]12[C@@]([C@@]3([C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])[H])([C@H]([C@H](C)C)CC2)[H]
Synonyms:- Dihydrobetulic acid
- (3β)-3-Hydroxylupan-28-oic acid
- Dihydrobetulinic acid
- Lupan-28-oic acid, 3-hydroxy-, (3β)-
- Lupan-28-oic acid, 3β-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dihydrobetulinic acid
CAS:<p>Dihydrobetulinic acid is a bioactive chemical.</p>Formula:C30H50O3Color and Shape:SolidMolecular weight:458.72
