CAS 25488-59-9
:(3R,4R)-3,4-bis(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-one
Description:
The chemical substance known as (3R,4R)-3,4-bis(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-one, with the CAS number 25488-59-9, is a complex organic compound characterized by its unique structural features. It contains a dihydrofuran ring, which contributes to its cyclic nature and potential reactivity. The presence of two 3,4-dimethoxybenzyl groups enhances its molecular complexity and may influence its solubility and interaction with biological systems. This compound is likely to exhibit specific stereochemical properties due to its (3R,4R) configuration, which can affect its pharmacological activity and binding affinity in biological contexts. Additionally, the methoxy groups can enhance lipophilicity, potentially impacting its absorption and distribution in living organisms. The compound may be of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications. However, detailed studies would be necessary to fully elucidate its biological activity, stability, and potential uses in various fields.
Formula:C22H26O6
InChI:InChI=1/C22H26O6/c1-24-18-7-5-14(11-20(18)26-3)9-16-13-28-22(23)17(16)10-15-6-8-19(25-2)21(12-15)27-4/h5-8,11-12,16-17H,9-10,13H2,1-4H3/t16-,17+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3R,4R)-3,4-Bis(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-one
CAS:(3R,4R)-3,4-Bis(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-onePurity:98%Molecular weight:386.44g/molDimethylmatairesinol
CAS:Formula:C22H26O6Purity:95%~99%Color and Shape:PowderMolecular weight:386.444Dimethylmatairesinol
CAS:Dimethylmatairesinol is a naturally occurring lignan derivative, which is predominantly sourced from plant materials such as the bark and heartwood of trees. It serves as a precursor to enterolignans, which are phytoestrogens. These compounds are metabolized by gut microbiota into enterodiol and enterolactone, exerting estrogen-like activity in the human body.
Formula:C22H26O6Purity:(Hplc-Ms) Min. 95 Area-%Color and Shape:White PowderMolecular weight:386.44 g/mol




