CAS 254889-31-1

11-cyclopropyl-4-methyl-5,11-dihydro-1H-dipyrido[3,2-b:2',3'-e][1,4]diazepine-2,6-dione

Description:

11-Cyclopropyl-4-methyl-5,11-dihydro-1H-dipyrido[3,2-b:2',3'-e][1,4]diazepine-2,6-dione is a complex organic compound characterized by its unique bicyclic structure, which incorporates both diazepine and pyridine rings. This compound features a cyclopropyl group and a methyl substituent, contributing to its distinct chemical properties and potential biological activity. The presence of the 2,6-dione functional groups suggests that it may exhibit reactivity typical of diketones, such as participating in condensation reactions or acting as a potential ligand in coordination chemistry. Its structural complexity may also influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 254889-31-1, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, highlighting its potential utility in pharmacological contexts.

Formula: C₁₅H₁₄N₄O₂

InChI: InChI=1/C15H14N4O2/c1-8-7-11(20)17-14-12(8)18-15(21)10-3-2-6-16-13(10)19(14)9-4-5-9/h2-3,6-7,9H,4-5H2,1H3,(H,17,20)(H,18,21)

SMILES: Cc1cc(nc2c1N=C(c1cccnc1N2C1CC1)O)O

2-Hydroxy Nevirapine

CAS: 254889-31-1

Formula: C₁₅H₁₄N₄O₂

Molecular weight: 282.30

Ref: 4Z-N-2210

2-Hydroxy Nevirapine

CAS: 254889-31-1

Applications A metabolite of Nevirapine (N391275).
References Rettie, A., et al.: J. Biol. Chem., 263, 13733 (1988), Lamson, M., et al.: Biopharm. Drug Dispos., 20, 285 (1999), Guengerich, F., et al.: Chem. Res. Toxicol., 14, 611 (2001), Lu, W., et al.: Drug Metab. Dispos., 36, 1624 (2008),

Formula: C₁₅H₁₄N₄O₂

Color and Shape: Neat

Molecular weight: 282.3

Ref: TR-H948625