CAS 2549-08-8
:N-(2-oxo-2H-chromen-3-yl)benzamide
Description:
N-(2-oxo-2H-chromen-3-yl)benzamide, with the CAS number 2549-08-8, is a chemical compound that features a chromenone moiety linked to a benzamide group. This compound typically exhibits a solid state at room temperature and is characterized by its aromatic structure, which contributes to its potential biological activity. The presence of the chromenone structure suggests that it may possess properties such as antioxidant, anti-inflammatory, or anticancer activities, as many compounds in this class are known for their pharmacological effects. The benzamide portion of the molecule can influence its solubility and interaction with biological targets. In terms of reactivity, the carbonyl groups in both the chromenone and benzamide functionalities may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Overall, N-(2-oxo-2H-chromen-3-yl)benzamide is of interest in medicinal chemistry and may serve as a lead compound for further development in therapeutic applications.
Formula:C16H11NO3
InChI:InChI=1/C16H11NO3/c18-15(11-6-2-1-3-7-11)17-13-10-12-8-4-5-9-14(12)20-16(13)19/h1-10H,(H,17,18)
SMILES:c1ccc(cc1)C(=Nc1cc2ccccc2oc1=O)O
Synonyms:- 3-Benzamidocoumarin
- Benzamide, N-(2-oxo-2H-1-benzopyran-3-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Benzamidocoumarin
CAS:3-Benzamidocoumarin is a synthetic compound, classified as a coumarin derivative, which is typically sourced through chemical synthesis in the laboratory. Its mode of action involves interaction with various biological pathways due to its inherent ability to act as a potent modulator of enzyme activity, and it serves as a scaffold for drug development. In biological systems, coumarins like 3-Benzamidocoumarin can exhibit a range of activities, including anticoagulant, antibacterial, and anti-inflammatory effects, largely attributed to their capacity to influence molecular signaling and cellular processes.
Formula:C16H11NO3Purity:Min. 95%Molecular weight:265.26 g/mol

