CAS 2549-78-2

1-hydroxy-3-methylanthracene-9,10-dione

Description:

1-Hydroxy-3-methylanthracene-9,10-dione, with the CAS number 2549-78-2, is an organic compound belonging to the anthraquinone family. It features a polycyclic aromatic structure characterized by three fused benzene rings and contains both hydroxyl and ketone functional groups. This compound typically exhibits a deep color, often appearing as a reddish or brownish solid, and is known for its potential applications in dyeing and as a fluorescent probe due to its ability to absorb and emit light. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the methylene and carbonyl groups influence its reactivity and stability. Additionally, 1-hydroxy-3-methylanthracene-9,10-dione can participate in various chemical reactions, including oxidation and reduction, making it of interest in organic synthesis and materials science. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions, but it is generally stable under standard laboratory conditions.

Formula: C₁₅H₁₀O₃

InChI: InChI=1/C15H10O3/c1-8-6-11-13(12(16)7-8)15(18)10-5-3-2-4-9(10)14(11)17/h2-7,16H,1H3

SMILES: Cc1cc2c(c(c1)O)C(=O)c1ccccc1C2=O

Synonyms:

• 1-Hydroxy-3-methyl-9,10-anthraquinone
• 9,10-Anthracenedione, 1-Hydroxy-3-Methyl-

Pachybasin

CAS: 2549-78-2

Formula: C₁₅H₁₀O₃

Purity: 86.94%

Color and Shape: Bright yellow. Powder

Molecular weight: 238.0

Ref: 8R-CL0460

Pachybasin

CAS: 2549-78-2

Pachybasin

Purity: ≥98%

Molecular weight: 238.24g/mol

Ref: 54-BUP07442

Pachybasin

CAS: 2549-78-2

Pachybasin is an anthraquinone fungal metabolite.

Formula: C₁₅H₁₀O₃

Purity: 99.73%

Color and Shape: Solid

Molecular weight: 238.24

Ref: TM-T37267

1-Hydroxy-3-methylanthraquinone

Controlled Product

CAS: 2549-78-2

Formula: C₁₅H₁₀O₃

Color and Shape: Neat

Molecular weight: 238.238

Ref: TR-H946445

1-Hydroxy-3-methylanthraquinone

CAS: 2549-78-2

1-Hydroxy-3-methylanthraquinone is a quinone compound that has been shown to have binding constants for the fungal filamentous fungus, Vulgare L. (strain pachybasin), and bacterial strains. This chemical has also been shown to have biological properties such as antimicrobial activity against Acetobacter aceti, inhibition of growth of the human pathogen Streptococcus pyogenes, and induction of locomotor activity in mice. 1-Hydroxy-3-methylanthraquinone binds to fatty acids in the cell membrane and alters the permeability of this membrane. 1HMR spectroscopy data suggests that this compound is regiospecific with respect to its two hydroxyl groups.

Formula: C₁₅H₁₀O₃

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-CAA54978