CAS 254993-59-4
:2-Chloro-4-(trifluoromethyl)benzeneboronic acid
Description:
2-Chloro-4-(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated aromatic ring. The compound features a chlorine atom and a trifluoromethyl group, which significantly influence its chemical reactivity and properties. It is typically a white to off-white solid that is soluble in polar organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity. Additionally, the presence of the chlorine atom can influence the electronic properties of the aromatic ring, potentially affecting its reactivity and interactions with other molecules. Overall, 2-Chloro-4-(trifluoromethyl)benzeneboronic acid is a versatile compound with applications in the development of pharmaceuticals and agrochemicals.
Formula:C7H5BClF3O2
InChI:InChI=1/C7H5BClF3O2/c9-4-1-2-6(8(13)14)5(3-4)7(10,11)12/h1-3,13-14H
SMILES:c1cc(c(cc1Cl)C(F)(F)F)B(O)O
Synonyms:- 2-Chloro-4-(trifluoromethyl)phenylboronic acid
- [4-Chloro-2-(Trifluoromethyl)Phenyl]Boronic Acid
- 2-Chloro-4-trifluoromethylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-(trifluoromethyl)benzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BClF3O2Purity:96%Color and Shape:White to cream or pale yellow, Crystals or powder or crystalline powderMolecular weight:224.382-Chloro-4-(trifluoromethyl)benzeneboronic acid
CAS:Formula:C7H5BClF3O2Purity:97%Color and Shape:SolidMolecular weight:224.37262-Chloro-4-(trifluoromethyl)benzeneboronic acid
CAS:2-Chloro-4-(trifluoromethyl)benzeneboronic acidFormula:C7H5BClF3O2Purity:98%Color and Shape: white solidMolecular weight:224.37g/mol2-Chloro-4-(trifluoromethyl)phenylboronic acid
CAS:Formula:C7H5BClF3O2Purity:98%Color and Shape:SolidMolecular weight:224.37




